CAS 19410-53-8 is the registry number for 8-Amino-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-amino-1,3-dimethyl-7H-purine-2,6-dione (CAS 19410-53-8) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: 8-amino-1,3-dimethyl-7H-purine-2,6-dione. InChIKey: ZZESAIGPDOBLKZ-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 8-amino-1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | ZZESAIGPDOBLKZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC(=N2)N |
Computed by PubChem (NCBI)