CAS 53498-52-5 appears in our catalog under these names: 2-Amino-7-(2-hydroxyethyl)-1H-purin-6(7H)-one, 97%, N7-(2-Hydroxyethyl)guanine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 50mg.
2-amino-7-(2-hydroxyethyl)-1H-purin-6-one (CAS 53498-52-5) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: 2-amino-7-(2-hydroxyethyl)-1H-purin-6-one. InChIKey: OCAWYYAMQRJCOY-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 2-amino-7-(2-hydroxyethyl)-1H-purin-6-one |
| InChIKey | OCAWYYAMQRJCOY-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1CCO)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)