Products 67304-67-0
CAS 67304-67-0 appears in our catalog under these names: 3-amino-5,7-dimethyl-2H,4H,5H,6H,7H-pyrazolo(3,4-d)pyrimidine-4,6-dione, 3-Amino-5,7-dimethyl-2H,4H,5H,6H,7H-pyrazolo(3,4-d)pyrimidine-4,6-dione, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 750mg, 5g, 1000mg, 500mg.
3-amino-5,7-dimethyl-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione (CAS 67304-67-0) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: 3-amino-5,7-dimethyl-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione. InChIKey: DBOGCXGDFZVKCG-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 3-amino-5,7-dimethyl-2H-pyrazolo[3,4-d]pyrimidine-4,6-dione |
| InChIKey | DBOGCXGDFZVKCG-UHFFFAOYSA-N |
| SMILES | CN1C2=NNC(=C2C(=O)N(C1=O)C)N |
Computed by PubChem (NCBI)