CAS 21379-40-8 is the registry number for Topiroxostat Impurity 60. Offered by: Chemat Brand. Available pack sizes: on request.
Pyridine-2,4-dicarbohydrazide (CAS 21379-40-8) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: pyridine-2,4-dicarbohydrazide. InChIKey: XILILYKJPFMMPH-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | pyridine-2,4-dicarbohydrazide |
| InChIKey | XILILYKJPFMMPH-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)NN)C(=O)NN |
Computed by PubChem (NCBI)