CAS 15420-53-8 is the registry number for Topiroxostat Impurity 56. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Pyridine-3,5-dicarbohydrazide (CAS 15420-53-8) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: pyridine-3,5-dicarbohydrazide. InChIKey: BSXGNABNXBZDAE-UHFFFAOYSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | pyridine-3,5-dicarbohydrazide |
| InChIKey | BSXGNABNXBZDAE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1C(=O)NN)C(=O)NN |
Computed by PubChem (NCBI)