Products 15420-53-8

CAS 15420-53-8 is the registry number for Topiroxostat Impurity 56. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Pyridine-3,5-dicarbohydrazide (CAS 15420-53-8) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 195.18 g/mol. IUPAC name: pyridine-3,5-dicarbohydrazide. InChIKey: BSXGNABNXBZDAE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9N5O2
Molecular weight195.18 g/mol
IUPAC namepyridine-3,5-dicarbohydrazide
InChIKeyBSXGNABNXBZDAE-UHFFFAOYSA-N
SMILESC1=C(C=NC=C1C(=O)NN)C(=O)NN

Computed by PubChem (NCBI)