CAS 1246820-07-4 appears in our catalog under these names: 2,3-Methylenedioxy Methamphetamine-d3 Hydrochloride (1.0mg/ml in Acetonitrile), 3,4-Methylenedioxy-N-methyl-d3-amphetamine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 10mg, 5mg, 25mg, 50mg.
1-(1,3-benzodioxol-4-yl)-N-(trideuteriomethyl)propan-2-amine;hydrochloride (CAS 1246820-07-4) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 232.72 g/mol. IUPAC name: 1-(1,3-benzodioxol-4-yl)-N-(trideuteriomethyl)propan-2-amine;hydrochloride. InChIKey: QSEQMDJEMZTQSW-MUTAZJQDSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 232.72 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-4-yl)-N-(trideuteriomethyl)propan-2-amine;hydrochloride |
| InChIKey | QSEQMDJEMZTQSW-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)CC1=C2C(=CC=C1)OCO2.Cl |
Computed by PubChem (NCBI)