Products 1247394-50-8
CAS 1247394-50-8 appears in our catalog under these names: 2,3-Dichloro-alpha-(1-methylethyl)-benzeneacetic acid, 95%, 2-(2,3-Dichlorophenyl)-3-methylbutanoic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(2,3-dichlorophenyl)-3-methylbutanoic acid (CAS 1247394-50-8) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-3-methylbutanoic acid. InChIKey: BHPGYMJYPXZCJF-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-3-methylbutanoic acid |
| InChIKey | BHPGYMJYPXZCJF-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=C(C(=CC=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)