CAS 1247455-96-4 appears in our catalog under these names: Methyl 2-chloro-2-(3,5-dimethoxyphenyl)acetate, 95%, Methyl 2-chloro-2-(3,5-dimethoxyphenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-chloro-2-(3,5-dimethoxyphenyl)acetate (CAS 1247455-96-4) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: methyl 2-chloro-2-(3,5-dimethoxyphenyl)acetate. InChIKey: RWNHCMSKBLURNY-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | methyl 2-chloro-2-(3,5-dimethoxyphenyl)acetate |
| InChIKey | RWNHCMSKBLURNY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(C(=O)OC)Cl)OC |
Computed by PubChem (NCBI)