CAS 56518-51-5 is the registry number for Ethyl 4-chloro-3,5-dimethoxybenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-chloro-3,5-dimethoxybenzoate (CAS 56518-51-5) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: ethyl 4-chloro-3,5-dimethoxybenzoate. InChIKey: PFGLBPRANZHDKB-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | ethyl 4-chloro-3,5-dimethoxybenzoate |
| InChIKey | PFGLBPRANZHDKB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)OC)Cl)OC |
Computed by PubChem (NCBI)