Products 39053-78-6

CAS 39053-78-6 is the registry number for 3,4,5-Trimethoxyphenylacetyl chloride, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-(3,4,5-trimethoxyphenyl)acetyl chloride (CAS 39053-78-6) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: 2-(3,4,5-trimethoxyphenyl)acetyl chloride. InChIKey: LDAQJWWSGNIDSE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO4
Molecular weight244.67 g/mol
IUPAC name2-(3,4,5-trimethoxyphenyl)acetyl chloride
InChIKeyLDAQJWWSGNIDSE-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)CC(=O)Cl

Computed by PubChem (NCBI)