CAS 766523-19-7 is the registry number for 3-Chloro-4,5-diethoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-chloro-4,5-diethoxybenzoic acid (CAS 766523-19-7) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: 3-chloro-4,5-diethoxybenzoic acid. InChIKey: MEADRIRYKFSBDO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 3-chloro-4,5-diethoxybenzoic acid |
| InChIKey | MEADRIRYKFSBDO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C(=O)O)Cl)OCC |
Computed by PubChem (NCBI)