CAS 1253202-34-4 is the registry number for (R)-3-Chloro-2-hydroxypropyl 4-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[(2R)-3-chloro-2-hydroxypropyl] 4-methoxybenzoate (CAS 1253202-34-4) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: [(2R)-3-chloro-2-hydroxypropyl] 4-methoxybenzoate. InChIKey: YEXAZFVNRQKMHP-VIFPVBQESA-N.
| Molecular formula | C11H13ClO4 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | [(2R)-3-chloro-2-hydroxypropyl] 4-methoxybenzoate |
| InChIKey | YEXAZFVNRQKMHP-VIFPVBQESA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)OC[C@H](CCl)O |
Computed by PubChem (NCBI)