Products 749920-56-7

CAS 749920-56-7 is the registry number for 3-Chloro-5-methoxy-4-(propan-2-yloxy)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

3-chloro-5-methoxy-4-propan-2-yloxybenzoic acid (CAS 749920-56-7) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: 3-chloro-5-methoxy-4-propan-2-yloxybenzoic acid. InChIKey: SHWDMVBTBWPOON-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO4
Molecular weight244.67 g/mol
IUPAC name3-chloro-5-methoxy-4-propan-2-yloxybenzoic acid
InChIKeySHWDMVBTBWPOON-UHFFFAOYSA-N
SMILESCC(C)OC1=C(C=C(C=C1Cl)C(=O)O)OC

Computed by PubChem (NCBI)