Products 2639387-38-3

CAS 2639387-38-3 is the registry number for 3-Chloro-5-(2-methoxyethoxy)-4-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-5-(2-methoxyethoxy)-4-methylbenzoic acid (CAS 2639387-38-3) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: 3-chloro-5-(2-methoxyethoxy)-4-methylbenzoic acid. InChIKey: WQNSCDUSPMFQLP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO4
Molecular weight244.67 g/mol
IUPAC name3-chloro-5-(2-methoxyethoxy)-4-methylbenzoic acid
InChIKeyWQNSCDUSPMFQLP-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1Cl)C(=O)O)OCCOC

Computed by PubChem (NCBI)