CAS 1247575-06-9 appears in our catalog under these names: 1-(2-Chlorophenyl)-1H-1,2,4-triazol-5-amine, 97%, 1-(2-Chlorophenyl)-1H-1,2,4-triazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
2-(2-chlorophenyl)-1,2,4-triazol-3-amine (CAS 1247575-06-9) is a chemical compound with the molecular formula C8H7ClN4 and a molecular weight of 194.62 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,2,4-triazol-3-amine. InChIKey: KJCHYTLXVUANBC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN4 |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,2,4-triazol-3-amine |
| InChIKey | KJCHYTLXVUANBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=NC=N2)N)Cl |
Computed by PubChem (NCBI)