CAS 1247607-26-6 is the registry number for 4-(4-Methyl-1,3-thiazol-2-yl)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-(4-methyl-1,3-thiazol-2-yl)benzenesulfonyl chloride (CAS 1247607-26-6) is a chemical compound with the molecular formula C10H8ClNO2S2 and a molecular weight of 273.8 g/mol. IUPAC name: 4-(4-methyl-1,3-thiazol-2-yl)benzenesulfonyl chloride. InChIKey: PGZQTWHYNQZABA-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 4-(4-methyl-1,3-thiazol-2-yl)benzenesulfonyl chloride |
| InChIKey | PGZQTWHYNQZABA-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)