CAS 1342075-96-0 appears in our catalog under these names: 3-(4-Methyl-1,3-thiazol-2-yl)benzene-1-sulfonyl chloride, 95%, 3-(4-Methyl-1,3-thiazol-2-yl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(4-methyl-1,3-thiazol-2-yl)benzenesulfonyl chloride (CAS 1342075-96-0) is a chemical compound with the molecular formula C10H8ClNO2S2 and a molecular weight of 273.8 g/mol. IUPAC name: 3-(4-methyl-1,3-thiazol-2-yl)benzenesulfonyl chloride. InChIKey: HWNHJFJAQSSLFN-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 3-(4-methyl-1,3-thiazol-2-yl)benzenesulfonyl chloride |
| InChIKey | HWNHJFJAQSSLFN-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)