CAS 320423-60-7 is the registry number for 5-((Benzenesulfonyl)methyl)-2-chloro-1,3-thiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(benzenesulfonylmethyl)-2-chloro-1,3-thiazole (CAS 320423-60-7) is a chemical compound with the molecular formula C10H8ClNO2S2 and a molecular weight of 273.8 g/mol. IUPAC name: 5-(benzenesulfonylmethyl)-2-chloro-1,3-thiazole. InChIKey: VTABKYKBOBZWCE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 5-(benzenesulfonylmethyl)-2-chloro-1,3-thiazole |
| InChIKey | VTABKYKBOBZWCE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC2=CN=C(S2)Cl |
Computed by PubChem (NCBI)