CAS 66047-75-4 appears in our catalog under these names: 3-(2-Methyl-thiazol-4-yl)-benzenesulfonyl chloride, 95+%, 3-(2-Methyl-thiazol-4-yl)-benzenesulfonyl chloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 5g.
3-(2-methyl-1,3-thiazol-4-yl)benzenesulfonyl chloride (CAS 66047-75-4) is a chemical compound with the molecular formula C10H8ClNO2S2 and a molecular weight of 273.8 g/mol. IUPAC name: 3-(2-methyl-1,3-thiazol-4-yl)benzenesulfonyl chloride. InChIKey: ZZGWJBAJNLBBRB-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 3-(2-methyl-1,3-thiazol-4-yl)benzenesulfonyl chloride |
| InChIKey | ZZGWJBAJNLBBRB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)