CAS 690632-88-3 appears in our catalog under these names: 4-Methyl-2-phenylthiazole-5-sulfonyl chloride, 97%, 4-Methyl-2-phenyl-1,3-thiazole-5-sulfonyl chloride, 95% . Offered by: AmBeed, Thermo Scientific. Available pack sizes: 1g, 250MG, 5g.
4-methyl-2-phenyl-1,3-thiazole-5-sulfonyl chloride (CAS 690632-88-3) is a chemical compound with the molecular formula C10H8ClNO2S2 and a molecular weight of 273.8 g/mol. IUPAC name: 4-methyl-2-phenyl-1,3-thiazole-5-sulfonyl chloride. InChIKey: NGDQQLAVJWUYSF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 4-methyl-2-phenyl-1,3-thiazole-5-sulfonyl chloride |
| InChIKey | NGDQQLAVJWUYSF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)