CAS 1394042-25-1 appears in our catalog under these names: 2-Methyl-5-phenyl-1,3-thiazole-4-sulfonyl chloride, 95%, 2-Methyl-5-phenyl-1,3-thiazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-methyl-5-phenyl-1,3-thiazole-4-sulfonyl chloride (CAS 1394042-25-1) is a chemical compound with the molecular formula C10H8ClNO2S2 and a molecular weight of 273.8 g/mol. IUPAC name: 2-methyl-5-phenyl-1,3-thiazole-4-sulfonyl chloride. InChIKey: ASNISBPRUHTOPC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 2-methyl-5-phenyl-1,3-thiazole-4-sulfonyl chloride |
| InChIKey | ASNISBPRUHTOPC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)