CAS 852180-73-5 appears in our catalog under these names: 4-(2-Methyl-1,3-thiazol-4-yl)benzenesulfonyl chloride, 95%, 4-(2-Methyl-thiazol-4-yl)-benzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
4-(2-methyl-1,3-thiazol-4-yl)benzenesulfonyl chloride (CAS 852180-73-5) is a chemical compound with the molecular formula C10H8ClNO2S2 and a molecular weight of 273.8 g/mol. IUPAC name: 4-(2-methyl-1,3-thiazol-4-yl)benzenesulfonyl chloride. InChIKey: JNGQNRAIASLBQA-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S2 |
|---|---|
| Molecular weight | 273.8 g/mol |
| IUPAC name | 4-(2-methyl-1,3-thiazol-4-yl)benzenesulfonyl chloride |
| InChIKey | JNGQNRAIASLBQA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)