Products 1247889-30-0
CAS 1247889-30-0 appears in our catalog under these names: 2-Cyclopentyl-4-oxazolecarboxylic Acid, 2-Cyclopentyloxazole-4-carboxylic acid, 98+%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-cyclopentyl-1,3-oxazole-4-carboxylic acid (CAS 1247889-30-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-cyclopentyl-1,3-oxazole-4-carboxylic acid. InChIKey: HMFSEYJFLNQHOM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-cyclopentyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | HMFSEYJFLNQHOM-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC(=CO2)C(=O)O |
Computed by PubChem (NCBI)