CAS 1248997-05-8 appears in our catalog under these names: 3-(3,5-Dichlorophenyl)-3-hydroxy-2,2-dimethylpropanoic acid, 95%, 3-(3,5-Dichlorophenyl)-3-hydroxy-2,2-dimethylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(3,5-dichlorophenyl)-3-hydroxy-2,2-dimethylpropanoic acid (CAS 1248997-05-8) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-3-hydroxy-2,2-dimethylpropanoic acid. InChIKey: MRIIZIFOBZCZMH-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)-3-hydroxy-2,2-dimethylpropanoic acid |
| InChIKey | MRIIZIFOBZCZMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=CC(=CC(=C1)Cl)Cl)O)C(=O)O |
Computed by PubChem (NCBI)