CAS 1249768-66-8 appears in our catalog under these names: 3-Fluoro-4-(1,3,4-oxadiazol-2-yl)aniline, 95%, 3-Fluoro-4-(1,3,4-oxadiazol-2-yl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-fluoro-4-(1,3,4-oxadiazol-2-yl)aniline (CAS 1249768-66-8) is a chemical compound with the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. IUPAC name: 3-fluoro-4-(1,3,4-oxadiazol-2-yl)aniline. InChIKey: SARQNTOPRMEPMW-UHFFFAOYSA-N.
| Molecular formula | C8H6FN3O |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 3-fluoro-4-(1,3,4-oxadiazol-2-yl)aniline |
| InChIKey | SARQNTOPRMEPMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)C2=NN=CO2 |
Computed by PubChem (NCBI)