Products 1250027-26-9

CAS 1250027-26-9 is the registry number for 2-(3-Methoxybenzenesulfinyl)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(3-methoxyphenyl)sulfinylacetic acid (CAS 1250027-26-9) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 2-(3-methoxyphenyl)sulfinylacetic acid. InChIKey: OGFLJDLMLDEPHB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10O4S
Molecular weight214.24 g/mol
IUPAC name2-(3-methoxyphenyl)sulfinylacetic acid
InChIKeyOGFLJDLMLDEPHB-UHFFFAOYSA-N
SMILESCOC1=CC(=CC=C1)S(=O)CC(=O)O

Computed by PubChem (NCBI)