Products 1250354-50-7
CAS 1250354-50-7 appears in our catalog under these names: 2,2-Difluoro-2-(o-tolyl)acetic acid, 95-<97%, 2,2-Difluoro-2-(2-methylphenyl)acetic acid, 98%, 2,2-Difluoro-2-(2-methylphenyl)acetic acid, 2,2-Difluoro-2-(2-methylphenyl)acetic acid, 98%, 98%. Offered by: Hoffman Fine Chemicals, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 0,5g, 50mg, 100mg, 250mg, 500mg.
2,2-difluoro-2-(2-methylphenyl)acetic acid (CAS 1250354-50-7) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 2,2-difluoro-2-(2-methylphenyl)acetic acid. InChIKey: SXQZXCPIDDTVQM-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 2,2-difluoro-2-(2-methylphenyl)acetic acid |
| InChIKey | SXQZXCPIDDTVQM-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(C(=O)O)(F)F |
Computed by PubChem (NCBI)