CAS 1250504-78-9 appears in our catalog under these names: 2-Cyclopropyl-5-fluorobenzoic acid, 95%, 2-Cyclopropyl-5-fluorobenzoic acid, 2-Cyclopropyl-5-fluorobenzoic acid, 98%, 98%, 2-Cyclopropyl-5-fluorobenzoic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
2-cyclopropyl-5-fluorobenzoic acid (CAS 1250504-78-9) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 2-cyclopropyl-5-fluorobenzoic acid. InChIKey: DKHIZIMQCGMRNO-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 2-cyclopropyl-5-fluorobenzoic acid |
| InChIKey | DKHIZIMQCGMRNO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)