CAS 1250656-10-0 is the registry number for 1-(2,6-Difluorophenyl)-2-hydroxyethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1-(2,6-difluorophenyl)-2-hydroxyethanone (CAS 1250656-10-0) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 1-(2,6-difluorophenyl)-2-hydroxyethanone. InChIKey: BCVRWMGPLHANSR-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)-2-hydroxyethanone |
| InChIKey | BCVRWMGPLHANSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)CO)F |
Computed by PubChem (NCBI)