Products 1251103-01-1
CAS 1251103-01-1 is the registry number for 2,6-Naphthyridine-3-carboxylic acid, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,6-naphthyridine-3-carboxylic acid (CAS 1251103-01-1) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 2,6-naphthyridine-3-carboxylic acid. InChIKey: FHYABEAASSIIKA-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 2,6-naphthyridine-3-carboxylic acid |
| InChIKey | FHYABEAASSIIKA-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=NC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,6-naphthyridine-3-carboxylic acid