CAS 2095410-33-4 is the registry number for 3-Amino-3-(2,6-difluorophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-amino-3-(2,6-difluorophenyl)propanoic acid;hydrochloride (CAS 2095410-33-4) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: 3-amino-3-(2,6-difluorophenyl)propanoic acid;hydrochloride. InChIKey: NHSOFWJNLOMRNW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO2 |
|---|---|
| Molecular weight | 237.63 g/mol |
| IUPAC name | 3-amino-3-(2,6-difluorophenyl)propanoic acid;hydrochloride |
| InChIKey | NHSOFWJNLOMRNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(CC(=O)O)N)F.Cl |
Computed by PubChem (NCBI)