Products 2095410-33-4

CAS 2095410-33-4 is the registry number for 3-Amino-3-(2,6-difluorophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-amino-3-(2,6-difluorophenyl)propanoic acid;hydrochloride (CAS 2095410-33-4) is a chemical compound with the molecular formula C9H10ClF2NO2 and a molecular weight of 237.63 g/mol. IUPAC name: 3-amino-3-(2,6-difluorophenyl)propanoic acid;hydrochloride. InChIKey: NHSOFWJNLOMRNW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClF2NO2
Molecular weight237.63 g/mol
IUPAC name3-amino-3-(2,6-difluorophenyl)propanoic acid;hydrochloride
InChIKeyNHSOFWJNLOMRNW-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)C(CC(=O)O)N)F.Cl

Computed by PubChem (NCBI)