Products 1251924-33-0
CAS 1251924-33-0 is the registry number for Benzyl 3-(aminomethyl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Benzyl 3-(aminomethyl)benzoate;hydrochloride (CAS 1251924-33-0) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: benzyl 3-(aminomethyl)benzoate;hydrochloride. InChIKey: PRZLLLIQMALKGO-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | benzyl 3-(aminomethyl)benzoate;hydrochloride |
| InChIKey | PRZLLLIQMALKGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC(=C2)CN.Cl |
Computed by PubChem (NCBI)