CAS 22710-97-0 appears in our catalog under these names: 2,3,4,5-Tetrahydro-1lambda6-benzothiepine-1,1,5-trione, 95%, 3,​4-​Dihydro-​1-benzothiepin-​5(2H)​-​one 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1,1-dioxo-3,4-dihydro-2H-1lambda6-benzothiepin-5-one (CAS 22710-97-0) is a chemical compound with the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-1lambda6-benzothiepin-5-one. InChIKey: UWJFARZPXSHTIB-UHFFFAOYSA-N.
| Molecular formula | C10H10O3S |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-1lambda6-benzothiepin-5-one |
| InChIKey | UWJFARZPXSHTIB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC=CC=C2S(=O)(=O)C1 |
Computed by PubChem (NCBI)