Products 1253398-39-8
CAS 1253398-39-8 is the registry number for Ethyl 2-oxo-3-(3,4,5-trimethoxybenzylidene)indoline-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3Z)-2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indole-5-carboxylate (CAS 1253398-39-8) is a chemical compound with the molecular formula C21H21NO6 and a molecular weight of 383.4 g/mol. IUPAC name: ethyl (3Z)-2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indole-5-carboxylate. InChIKey: NPSOMTLUHTZTPQ-NVNXTCNLSA-N.
| Molecular formula | C21H21NO6 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | ethyl (3Z)-2-oxo-3-[(3,4,5-trimethoxyphenyl)methylidene]-1H-indole-5-carboxylate |
| InChIKey | NPSOMTLUHTZTPQ-NVNXTCNLSA-N |
| SMILES | CCOC(=O)C1=CC\2=C(C=C1)NC(=O)/C2=C\C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)