CAS 175452-89-8 appears in our catalog under these names: N-Fmoc-D-glutamic acid 1-methyl ester, 97%, Fmoc–D–Glu–OMe, Fmoc-D-Glu-Ome 98%, N-Fmoc-D-glutamic Acid 1-Methyl Ester, 98%, 98%, N-FMOC-D-GLUTAMIC ACID 1-METHYL ESTER, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 5g, 1g, 100mg, 250mg.
(4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methoxy-5-oxopentanoic acid (CAS 175452-89-8) is a chemical compound with the molecular formula C21H21NO6 and a molecular weight of 383.4 g/mol. IUPAC name: (4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methoxy-5-oxopentanoic acid. InChIKey: GVVDKFNHFXLOQY-GOSISDBHSA-N.
| Molecular formula | C21H21NO6 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methoxy-5-oxopentanoic acid |
| InChIKey | GVVDKFNHFXLOQY-GOSISDBHSA-N |
| SMILES | COC(=O)[C@@H](CCC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)