CAS 879551-17-4 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)pentanedioic acid, 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)pentanedioic acid, 98%, 98%, Fmoc-N-Me-L-Glu-OH, 98%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 250mg.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanedioic acid (CAS 879551-17-4) is a chemical compound with the molecular formula C21H21NO6 and a molecular weight of 383.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanedioic acid. InChIKey: FGKBEQMQAJSEQI-SFHVURJKSA-N.
| Molecular formula | C21H21NO6 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]pentanedioic acid |
| InChIKey | FGKBEQMQAJSEQI-SFHVURJKSA-N |
| SMILES | CN([C@@H](CCC(=O)O)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)