CAS 250384-77-1 appears in our catalog under these names: Fmoc-L-2-aminoadipic acid, 97%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanedioic acid, 96%, 96%, Fmoc-L-a-aminoadipic acid, 96%, Fmoc-Aad-OH, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanedioic acid (CAS 250384-77-1) is a chemical compound with the molecular formula C21H21NO6 and a molecular weight of 383.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanedioic acid. InChIKey: DSQHYGKLDYXUSA-SFHVURJKSA-N.
| Molecular formula | C21H21NO6 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanedioic acid |
| InChIKey | DSQHYGKLDYXUSA-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)