CAS 181817-14-1 appears in our catalog under these names: O-Acetyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-threonine, 98%, 98%, (2S,3R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-acetoxybutanoic acid, 98%, Fmoc-Thr(AC)-OH, 99%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g.
(2S,3R)-3-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 181817-14-1) is a chemical compound with the molecular formula C21H21NO6 and a molecular weight of 383.4 g/mol. IUPAC name: (2S,3R)-3-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: ZITLPPLNBYOLDJ-BLVKFPJESA-N.
| Molecular formula | C21H21NO6 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2S,3R)-3-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | ZITLPPLNBYOLDJ-BLVKFPJESA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(=O)C |
Computed by PubChem (NCBI)