CAS 377087-65-5 appears in our catalog under these names: Fmoc-iminodipropionic acid, 98%, Fmoc-Idp-OH. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 1g, 250mg, 100mg.
3-[2-carboxyethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 377087-65-5) is a chemical compound with the molecular formula C21H21NO6 and a molecular weight of 383.4 g/mol. IUPAC name: 3-[2-carboxyethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: DUZRLPKOGSOKML-UHFFFAOYSA-N.
| Molecular formula | C21H21NO6 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 3-[2-carboxyethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | DUZRLPKOGSOKML-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CCC(=O)O)CCC(=O)O |
Computed by PubChem (NCBI)