CAS 218457-73-9 appears in our catalog under these names: Fmoc-D-2-aminoadipic acid, 95%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanedioic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 10g, 25g, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanedioic acid (CAS 218457-73-9) is a chemical compound with the molecular formula C21H21NO6 and a molecular weight of 383.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanedioic acid. InChIKey: DSQHYGKLDYXUSA-GOSISDBHSA-N.
| Molecular formula | C21H21NO6 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanedioic acid |
| InChIKey | DSQHYGKLDYXUSA-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)