CAS 1255099-02-5 is the registry number for 1-(6-Methoxypyridin-2-yl)cyclopropanamine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
1-(6-methoxy-2-pyridinyl)cyclopropan-1-amine;dihydrochloride (CAS 1255099-02-5) is a chemical compound with the molecular formula C9H14Cl2N2O and a molecular weight of 237.12 g/mol. IUPAC name: 1-(6-methoxy-2-pyridinyl)cyclopropan-1-amine;dihydrochloride. InChIKey: MAGONELSXQWUTF-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O |
|---|---|
| Molecular weight | 237.12 g/mol |
| IUPAC name | 1-(6-methoxy-2-pyridinyl)cyclopropan-1-amine;dihydrochloride |
| InChIKey | MAGONELSXQWUTF-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=N1)C2(CC2)N.Cl.Cl |
Computed by PubChem (NCBI)