CAS 125558-96-5 appears in our catalog under these names: 6-Hydroxy-2-methyl-4h-3,1-benzoxazin-4-one, 95%, 6-Hydroxy-2-methyl-4H-benzo(d)(1,3)oxazin-4-one, 95+%, 6-Hydroxy-2-methyl-4H-3,1-benzoxazin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-hydroxy-2-methyl-3,1-benzoxazin-4-one (CAS 125558-96-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 6-hydroxy-2-methyl-3,1-benzoxazin-4-one. InChIKey: NUTQQQZGXDLLMH-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 6-hydroxy-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | NUTQQQZGXDLLMH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)O)C(=O)O1 |
Computed by PubChem (NCBI)