Products 2203071-82-1
CAS 2203071-82-1 is the registry number for 1-(Pyrrolidin-1-ylmethyl)cyclopropane-1-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-(pyrrolidin-1-ylmethyl)cyclopropane-1-carboxylic acid;hydrochloride (CAS 2203071-82-1) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: 1-(pyrrolidin-1-ylmethyl)cyclopropane-1-carboxylic acid;hydrochloride. InChIKey: QQQKLBIRKPJKTO-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 1-(pyrrolidin-1-ylmethyl)cyclopropane-1-carboxylic acid;hydrochloride |
| InChIKey | QQQKLBIRKPJKTO-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2(CC2)C(=O)O.Cl |
Computed by PubChem (NCBI)