CAS 1255788-88-5 is the registry number for 3-Amino-6-methyl-2-thioxo-1,2,3,5-tetrahydro-4H-pyrrolo[3,2-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-6-methyl-2-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (CAS 1255788-88-5) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: 3-amino-6-methyl-2-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one. InChIKey: QDMRGQOHJNJZPL-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 3-amino-6-methyl-2-sulfanylidene-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| InChIKey | QDMRGQOHJNJZPL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1)C(=O)N(C(=S)N2)N |
Computed by PubChem (NCBI)