CAS 31877-60-8 is the registry number for 5-(2,4-Dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-amine (CAS 31877-60-8) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: 5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-amine. InChIKey: ABOJALZOKCQIGS-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 5-(2,4-dimethyl-1,3-thiazol-5-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | ABOJALZOKCQIGS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C2=NN=C(O2)N |
Computed by PubChem (NCBI)