CAS 98277-21-5 is the registry number for 5-(3,5-Dimethylisoxazol-4-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,3,4-thiadiazol-2-amine (CAS 98277-21-5) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: 5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,3,4-thiadiazol-2-amine. InChIKey: OMYCWVHALHKDBX-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,3,4-thiadiazol-2-amine |
| InChIKey | OMYCWVHALHKDBX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=NN=C(S2)N |
Computed by PubChem (NCBI)