CAS 500874-32-8 is the registry number for 2-Methyl-6-(methylthio)-1,2-dihydro-3H-pyrazolo[3,4-d]pyrimidin-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one (CAS 500874-32-8) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: 2-methyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one. InChIKey: XWEGHFZOYNDTNB-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 2-methyl-6-methylsulfanyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
| InChIKey | XWEGHFZOYNDTNB-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CN=C(N=C2N1)SC |
Computed by PubChem (NCBI)