CAS 885880-20-6 is the registry number for 3-Amino-8-methyl-2H,6H-pyrimido[2,1-b][1,3,4]thiadiazin-6-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-8-methyl-2H-pyrimido[2,1-b][1,3,4]thiadiazin-6-one (CAS 885880-20-6) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: 3-amino-8-methyl-2H-pyrimido[2,1-b][1,3,4]thiadiazin-6-one. InChIKey: RPDQVGGDAYZPIC-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 3-amino-8-methyl-2H-pyrimido[2,1-b][1,3,4]thiadiazin-6-one |
| InChIKey | RPDQVGGDAYZPIC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)SCC(=N2)N |
Computed by PubChem (NCBI)