CAS 2106614-78-0 is the registry number for (5-(2-Methylthiazol-4-yl)-1H-1,2,4-triazol-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(2-methyl-1,3-thiazol-4-yl)-1H-1,2,4-triazol-5-yl]methanol (CAS 2106614-78-0) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: [3-(2-methyl-1,3-thiazol-4-yl)-1H-1,2,4-triazol-5-yl]methanol. InChIKey: SGRMYGPKWLZNAZ-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | [3-(2-methyl-1,3-thiazol-4-yl)-1H-1,2,4-triazol-5-yl]methanol |
| InChIKey | SGRMYGPKWLZNAZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=NNC(=N2)CO |
Computed by PubChem (NCBI)