CAS 170959-40-7 is the registry number for 4-Methyl-5-(4-methyl-1,3-oxazol-5-yl)-2,4-dihydro-3h-1,2,4-triazole-3-thione, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
4-methyl-3-(4-methyl-1,3-oxazol-5-yl)-1H-1,2,4-triazole-5-thione (CAS 170959-40-7) is a chemical compound with the molecular formula C7H8N4OS and a molecular weight of 196.23 g/mol. IUPAC name: 4-methyl-3-(4-methyl-1,3-oxazol-5-yl)-1H-1,2,4-triazole-5-thione. InChIKey: NQITUZDGXBAHQQ-UHFFFAOYSA-N.
| Molecular formula | C7H8N4OS |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 4-methyl-3-(4-methyl-1,3-oxazol-5-yl)-1H-1,2,4-triazole-5-thione |
| InChIKey | NQITUZDGXBAHQQ-UHFFFAOYSA-N |
| SMILES | CC1=C(OC=N1)C2=NNC(=S)N2C |
Computed by PubChem (NCBI)